| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,2'-Bipyrazine |
|---|---|
| Synonyms | 2,2-BIPYRAZINE; bipyrazine; InChI=1/C8H6N4/c1-3-11-7(5-9-1)8-6-10-2-4-12-8/h1-6H |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6N4 |
| Molecular Weight | 158.16 |
| CAS Registry Number | 10199-00-5 |
| SMILES | C1=CN=C(C=N1)C2=NC=CN=C2 |
| InChI | 1S/C8H6N4/c1-3-11-7(5-9-1)8-6-10-2-4-12-8/h1-6H |
| InChIKey | DFXNVSIALRDJHY-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 299.0±35.0°C at 760 mmHg (Cal.) |
| Flash point | 138.4±18.9°C (Cal.) |
| Refractive index | 1.592 (Cal.) |
| SDS | Available |
|---|---|
| (1) | Feng-Rong Dai, Jing-Lin Chen, Heng-Yun Ye, Li-Yi Zhang and Zhong-Ning Chen. Syntheses, characterization and redox properties of oxo-centred trirutheniumcluster dimers and trimers linked by ortho-metallated polypyridyl ligands, Dalton Trans., 2008, 1492. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,2'-Bipyrazine |