| Luminescence Technology Corp. | Taiwan | Inquire | ||
|---|---|---|---|---|
![]() | www.lumtec.com.tw | |||
![]() | +886 (2) 2697-5600 | |||
![]() | +886 (2) 2697-5601 | |||
![]() | sales@lumtec.com.tw | |||
| Chemical manufacturer since 1999 | ||||
| chemBlink Standard supplier since 2024 | ||||
| Classification | Pharmaceutical intermediate >> Heterocyclic compound intermediate >> Isoquinoline compound |
|---|---|
| Name | 2,9-Bis(3-((3-(dimethylamino)propyl)amino)propyl)anthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)-tetraone |
| Synonyms | 7,18-bis[3-[3-(dimethylamino)propylamino]propyl]-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone |
| Molecular Structure | ![]() |
| Molecular Formula | C40H46N6O4 |
| Molecular Weight | 674.83 |
| CAS Registry Number | 1020180-01-1 |
| SMILES | CN(C)CCCNCCCN1C(=O)C2=C3C(=CC=C4C3=C(C=C2)C5=C6C4=CC=C7C6=C(C=C5)C(=O)N(C7=O)CCCNCCCN(C)C)C1=O |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319 Details |
| Safety Statements | P501-P270-P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330 Details |
| SDS | Available |
|
2,9-Bis(3-((3-(dimethylamino)propyl)amino)propyl)anthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)-tetraone is a complex chemical compound that has drawn attention due to its distinctive structure and potential applications in a variety of advanced materials and biological fields. The molecule contains a combination of anthraquinone and isoquinoline core structures, which are substituted with amine groups that contribute to its chemical reactivity and interaction properties. These properties make the compound promising for research in areas such as molecular electronics, drug development, and sensing technologies. The discovery of 2,9-Bis(3-((3-(dimethylamino)propyl)amino)propyl)anthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)-tetraone is part of ongoing efforts to design molecules with highly specific interactions, particularly for biological and electronic applications. The compound's complex structure, which incorporates functional amine groups, makes it versatile for designing materials that can interact with both organic and inorganic substrates. Its molecular architecture suggests potential for high stability and reactivity, which are critical for its use in a variety of chemical environments. In terms of applications, the compound shows great promise in the field of molecular electronics. The electron-rich nature of the anthraquinone and isoquinoline parts of the molecule allows for effective electron transfer, making it useful in the development of organic semiconductors and other electronic materials. Additionally, the presence of dimethylamino groups enhances the molecule's ability to interact with other materials, making it an excellent candidate for applications in organic light-emitting diodes (OLEDs) and organic photovoltaics (OPVs). These types of materials rely on the efficient movement of charge carriers, and the structure of this compound suggests it could play a significant role in enhancing the performance of such devices. Another potential application lies in drug development, where the compound's amine groups could interact with biological targets. The molecule's ability to form complexes with metal ions or proteins might make it suitable for use in therapies that require specific molecular recognition or targeting. Its structural features are conducive to binding with biomolecules, and ongoing research could reveal its potential in developing treatments for diseases that involve molecular miscommunication or improper cellular signaling. The synthesis of 2,9-Bis(3-((3-(dimethylamino)propyl)amino)propyl)anthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)-tetraone involves several steps of organic synthesis, including the introduction of the amine groups via nucleophilic substitution reactions. The preparation of such a complex compound requires careful control of reaction conditions to ensure the stability and purity of the final product. The synthetic approach used is critical for achieving the desired properties, such as solubility, reactivity, and stability under operational conditions. In conclusion, 2,9-Bis(3-((3-(dimethylamino)propyl)amino)propyl)anthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)-tetraone is a promising compound with applications in molecular electronics and drug development. Its complex structure, which facilitates both electronic and biological interactions, positions it as an important candidate for future technological advancements in organic electronics and therapeutic chemistry. References 2024. Medium bandgap A-DA’D-A type small molecule acceptors prepared by synergetic modification strategy for efficient indoor organic photovoltaic devices. Science China Materials. DOI: 10.1007/s40843-024-3135-3 |
| Market Analysis Reports |
| List of Reports Available for 2,9-Bis(3-((3-(dimethylamino)propyl)amino)propyl)anthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)-tetraone |