|
CAS#: 102073-77-8 Product: 5,8-Dimethoxy-1,2,3,4-Tetrahydroisoquinolin-4-Ol Hydrochloride No suppilers available for the product. |
| Name | 5,8-Dimethoxy-1,2,3,4-Tetrahydroisoquinolin-4-Ol Hydrochloride |
|---|---|
| Synonyms | Zinc04218417 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16NO3 |
| Molecular Weight | 210.25 |
| CAS Registry Number | 102073-77-8 |
| SMILES | [C@H]1(O)C[NH2+]CC2=C(OC)C=CC(=C12)OC |
| InChI | 1S/C11H15NO3/c1-14-9-3-4-10(15-2)11-7(9)5-12-6-8(11)13/h3-4,8,12-13H,5-6H2,1-2H3/p+1/t8-/m0/s1 |
| InChIKey | WHRGDXAUJLJDPU-QMMMGPOBSA-O |
| Boiling point | 395.306°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 192.874°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,8-Dimethoxy-1,2,3,4-Tetrahydroisoquinolin-4-Ol Hydrochloride |