Online Database of Chemicals from Around the World
|
CAS#: 1021-19-8 Product: 1,3,3a,4,7,7a-Hexahydro-4,5,6,7,8,8-Hexachloro-4,7-Methanoisobenzofuran-1-Ol No suppilers available for the product. |
| Name | 1,3,3a,4,7,7a-Hexahydro-4,5,6,7,8,8-Hexachloro-4,7-Methanoisobenzofuran-1-Ol |
|---|---|
| Synonyms | Endosulfan Alpha-Hydroxy Ether; Endosulfan Hydroxyether; 1,3,3A,4,7,7A-Hexahydro-4,5,6,7,8,8-Hexachloro-4,7-Methanoisobenzofuran-1-Ol |
| Molecular Structure |  |
| Molecular Formula | C9H6Cl6O2 |
| Molecular Weight | 358.86 |
| CAS Registry Number | 1021-19-8 |
| SMILES | C2C1C3(C(=C(C(C1C(O2)O)(C3(Cl)Cl)Cl)Cl)Cl)Cl |
| InChI | 1S/C9H6Cl6O2/c10-4-5(11)8(13)3-2(1-17-6(3)16)7(4,12)9(8,14)15/h2-3,6,16H,1H2 |
| InChIKey | OHANHNSPGZXJBU-UHFFFAOYSA-N |
| Density | 1.886g/cm3 (Cal.) |
|---|---|
| Boiling point | 418.332°C at 760 mmHg (Cal.) |
| Flash point | 206.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,3a,4,7,7a-Hexahydro-4,5,6,7,8,8-Hexachloro-4,7-Methanoisobenzofuran-1-Ol |