| Anhui Primechem Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.primekem.com | |||
![]() | +86 (551) 6283-5529 | |||
![]() | henry@primekem.com | |||
| Chemical distributor since 2009 | ||||
| chemBlink Standard supplier since 2024 | ||||
| Classification | Biochemical >> Natural biochemical product |
|---|---|
| Name | Eremophilene |
| Synonyms | (3R,4aR,5S)-4a,5-dimethyl-3-prop-1-en-2-yl-2,3,4,5,6,7-hexahydro-1H-naphthalene |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 |
| CAS Registry Number | 10219-75-7 |
| SMILES | C[C@H]1CCC=C2[C@@]1(C[C@@H](CC2)C(=C)C)C |
| Solubility | 0.05011 mg/L (25 °C water) |
|---|---|
| Density | 0.9±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.495, Calc.* |
| Melting point | 29.52 °C |
| Boiling Point | 270.5±20.0 °C (760 mmHg), Calc.*, 253.52 °C |
| Flash Point | 106.0±16.6 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Eremophilene |