Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
|
+380 (44) 522-2458 | |||
|
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | Butan-2-Yl 4-Amino-2-Hydroxybenzoate |
|---|---|
| Synonyms | Sec-Butyl 4-Amino-2-Hydroxy-Benzoate; 4-Amino-2-Hydroxybenzoic Acid Sec-Butyl Ester; 4-Amino-2-Hydroxy-Benzoic Acid Sec-Butyl Ester |
| Molecular Structure |  |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 |
| CAS Registry Number | 102338-91-0 |
| SMILES | C1=CC(=CC(=C1C(OC(CC)C)=O)O)N |
| InChI | 1S/C11H15NO3/c1-3-7(2)15-11(14)9-5-4-8(12)6-10(9)13/h4-7,13H,3,12H2,1-2H3 |
| InChIKey | HBLYGPYKPGHAFS-UHFFFAOYSA-N |
| Density | 1.176g/cm3 (Cal.) |
|---|---|
| Boiling point | 354.764°C at 760 mmHg (Cal.) |
| Flash point | 168.356°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Butan-2-Yl 4-Amino-2-Hydroxybenzoate |