Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
|
+380 (44) 522-2458 | |||
|
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 4-Methylnaphthalen-1-Ol |
|---|---|
| Synonyms | 4-Methyl-1-Naphthalenol; 4-Methyl-1-Naphthol; 1-Naphthalenol, 4-Ethyl- |
| Molecular Structure |  |
| Molecular Formula | C11H10O |
| Molecular Weight | 158.20 |
| CAS Registry Number | 10240-08-1 |
| EINECS | 233-573-2 |
| SMILES | C1=CC2=C(C=C1)C(=CC=C2O)C |
| InChI | 1S/C11H10O/c1-8-6-7-11(12)10-5-3-2-4-9(8)10/h2-7,12H,1H3 |
| InChIKey | ZSUDUDXOEGHEJR-UHFFFAOYSA-N |
| Density | 1.144g/cm3 (Cal.) |
|---|---|
| Boiling point | 310.135°C at 760 mmHg (Cal.) |
| Flash point | 150.276°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methylnaphthalen-1-Ol |