Online Database of Chemicals from Around the World
|
CAS#: 10273-84-4 Product: 9,10-Anthracenediylbis(Methylene) Diacetate No suppilers available for the product. |
| Name | 9,10-Anthracenediylbis(Methylene) Diacetate |
|---|---|
| Synonyms | (10-[(Acetyloxy)methyl]-9-anthryl)methyl acetate # |
| Molecular Structure |  |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.35 |
| CAS Registry Number | 10273-84-4 |
| SMILES | O=C(OCc2c1c(cccc1)c(c3c2cccc3)COC(=O)C)C |
| InChI | 1S/C20H18O4/c1-13(21)23-11-19-15-7-3-5-9-17(15)20(12-24-14(2)22)18-10-6-4-8-16(18)19/h3-10H,11-12H2,1-2H3 |
| InChIKey | BVPQUFPFMVPKTA-UHFFFAOYSA-N |
| Density | 1.224g/cm3 (Cal.) |
|---|---|
| Boiling point | 480.256°C at 760 mmHg (Cal.) |
| Flash point | 243.434°C (Cal.) |
| Refractive index | 1.632 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 9,10-Anthracenediylbis(Methylene) Diacetate |