|
CAS#: 10285-80-0 Product: N-(3-Buten-1-Yl)-4-Methylbenzenesulfonamide No suppilers available for the product. |
| Name | N-(3-Buten-1-Yl)-4-Methylbenzenesulfonamide |
|---|---|
| Synonyms | Benzenesulfonamide, N-3-buten-1-yl-4-methyl-; Benzenesulfonamide,N-3-buten-1-yl-4-methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 |
| CAS Registry Number | 10285-80-0 |
| SMILES | O=S(=O)(c1ccc(cc1)C)NCC\C=C |
| InChI | 1S/C11H15NO2S/c1-3-4-9-12-15(13,14)11-7-5-10(2)6-8-11/h3,5-8,12H,1,4,9H2,2H3 |
| InChIKey | RCKDLNPOJFRDOH-UHFFFAOYSA-N |
| Density | 1.121g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.938°C at 760 mmHg (Cal.) |
| Flash point | 159.994°C (Cal.) |
| Refractive index | 1.531 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(3-Buten-1-Yl)-4-Methylbenzenesulfonamide |