Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3,6-Dimethylisoquinoline |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C11H11N |
| Molecular Weight | 157.21 |
| CAS Registry Number | 102878-58-0 |
| SMILES | CC1=CC2=C(C=C1)C=NC(=C2)C |
| InChI | 1S/C11H11N/c1-8-3-4-10-7-12-9(2)6-11(10)5-8/h3-7H,1-2H3 |
| InChIKey | OUSUBDOSELFGLT-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 273.7±9.0°C at 760 mmHg (Cal.) |
| Flash point | 114.3±11.4°C (Cal.) |
| Refractive index | 1.611 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,6-Dimethylisoquinoline |