|
CAS#: 103026-83-1 Product: Isobutyl Methyl 2,6-Dimethyl-4-(2-Nitrophenyl)-3,5-Pyridinedicarboxylate No suppilers available for the product. |
| Name | Isobutyl Methyl 2,6-Dimethyl-4-(2-Nitrophenyl)-3,5-Pyridinedicarboxylate |
|---|---|
| Synonyms | Dehydro Nisoldipine |
| Molecular Structure | ![]() |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 |
| CAS Registry Number | 103026-83-1 |
| SMILES | O=C(OCC(C)C)c1c(c(c(nc1C)C)C(=O)OC)c2ccccc2[N+]([O-])=O |
| InChI | 1S/C20H22N2O6/c1-11(2)10-28-20(24)17-13(4)21-12(3)16(19(23)27-5)18(17)14-8-6-7-9-15(14)22(25)26/h6-9,11H,10H2,1-5H3 |
| InChIKey | PCNPLNDGLOCZGS-UHFFFAOYSA-N |
| Density | 1.215g/cm3 (Cal.) |
|---|---|
| Boiling point | 475.029°C at 760 mmHg (Cal.) |
| Flash point | 241.089°C (Cal.) |
| Refractive index | 1.558 (Cal.) |
| (1) | Hui Chen, Jing Luo, Lin-Lin Jing and Ru Jiang . 3-Isobutyl 5-methyl 2,6-dimethyl-4-(2-nitrophenyl)pyridine-3,5-dicarboxylate , Acta Cryst (2010). E66, o86Â Â |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Isobutyl Methyl 2,6-Dimethyl-4-(2-Nitrophenyl)-3,5-Pyridinedicarboxylate |