Online Database of Chemicals from Around the World
|
CAS#: 103106-19-0 Product: Napyradiomycin C2 No suppilers available for the product. |
| Name | Napyradiomycin C2 |
|---|---|
| Synonyms | 7,18A-Methano-6,10-Metheno-5H-Cyclohexadeca(B)Pyran-5,19-Dione, 3,4A,13-Trichloro-2,3,4,4A,11,12,13,14,15,18-Decahydro-9,20-Dihydroxy-2,2,16-Trimethyl-12-Methylene- |
| Molecular Structure |  |
| Molecular Formula | C25H27Cl3O5 |
| Molecular Weight | 513.84 |
| CAS Registry Number | 103106-19-0 |
| SMILES | CC4(OC23C(Cl)(C(=O)C1=C(O)C(=C(O)C=C1C2=O)CC(C(Cl)CCC(=C/C3)/C)=C)CC4Cl)C |
| InChI | 1S/C25H27Cl3O5/c1-12-5-6-16(26)13(2)9-14-17(29)10-15-19(20(14)30)22(32)24(28)11-18(27)23(3,4)33-25(24,8-7-12)21(15)31/h7,10,16,18,29-30H,2,5-6,8-9,11H2,1,3-4H3/b12-7+ |
| InChIKey | TUASWIIAAPWHMO-KPKJPENVSA-N |
| Density | 1.423g/cm3 (Cal.) |
|---|---|
| Boiling point | 714.272°C at 760 mmHg (Cal.) |
| Flash point | 385.778°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Napyradiomycin C2 |