Online Database of Chemicals from Around the World
| Name | 7-(Chloromethyl)Fluoranthene |
|---|---|
| Synonyms | 7-Chloromethylfluoranthene; Ccris 5207; Fluoranthene, 7-(Chloromethyl)- |
| Molecular Structure |  |
| Molecular Formula | C17H11Cl |
| Molecular Weight | 250.73 |
| CAS Registry Number | 103393-71-1 |
| SMILES | C3=C1C4=C(C2=CC=CC(=C12)C=C3)C(=CC=C4)CCl |
| InChI | 1S/C17H11Cl/c18-10-12-6-3-8-14-13-7-1-4-11-5-2-9-15(16(11)13)17(12)14/h1-9H,10H2 |
| InChIKey | YQWDZLYVEVNEIF-UHFFFAOYSA-N |
| Density | 1.322g/cm3 (Cal.) |
|---|---|
| Boiling point | 434.089°C at 760 mmHg (Cal.) |
| Flash point | 201.163°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-(Chloromethyl)Fluoranthene |
