Online Database of Chemicals from Around the World
|
CAS#: 103629-94-3 Product: Roxburghiadiol A No suppilers available for the product. |
| Name | Roxburghiadiol A |
|---|---|
| Synonyms | 9,19-Cycloergost-24(28)-Ene-3,6-Diol, 14-Methyl-, (3Beta,5Alpha,6Alpha)-; Roxburghiadiol A; Roxburghiadiol B |
| Molecular Structure |  |
| Molecular Formula | C29H48O2 |
| Molecular Weight | 428.70 |
| CAS Registry Number | 103629-94-3 |
| SMILES | [C@]245[C@@]1([C@H](C[C@H](CC1)O)[C@H](C[C@H]2[C@@]3(CC[C@@H]([C@]3(CC4)C)[C@@H](CCC(=C)C(C)C)C)C)O)C5 |
| InChI | 1S/C29H48O2/c1-18(2)19(3)7-8-20(4)22-10-11-27(6)25-16-24(31)23-15-21(30)9-12-28(23)17-29(25,28)14-13-26(22,27)5/h18,20-25,30-31H,3,7-17H2,1-2,4-6H3/t20-,21+,22-,23-,24+,25+,26-,27+,28-,29+/m1/s1 |
| InChIKey | FLFAKBJFVNSCHC-HFOFPBCXSA-N |
| Density | 1.059g/cm3 (Cal.) |
|---|---|
| Boiling point | 531.753°C at 760 mmHg (Cal.) |
| Flash point | 219.156°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Roxburghiadiol A |