Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Ethyl {[Methyl(Nitro)Amino]Methyl}Carbamate |
|---|---|
| Synonyms | ethyl ((methyl(nitro)amino)methyl)carbamate |
| Molecular Structure | ![CAS#: 103635-49-0， Ethyl {[Methyl(Nitro)Amino]Methyl}Carbamate](/moreStructures/103635-49-0.gif) |
| Molecular Formula | C5H11N3O4 |
| Molecular Weight | 177.16 |
| CAS Registry Number | 103635-49-0 |
| SMILES | CCOC(=O)NCN(C)[N+](=O)[O-] |
| InChI | 1S/C5H11N3O4/c1-3-12-5(9)6-4-7(2)8(10)11/h3-4H2,1-2H3,(H,6,9) |
| InChIKey | KOCLHQLESPYUBK-UHFFFAOYSA-N |
| Density | 1.235g/cm3 (Cal.) |
|---|---|
| Boiling point | 357.711°C at 760 mmHg (Cal.) |
| Flash point | 170.138°C (Cal.) |
| Refractive index | 1.474 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl {[Methyl(Nitro)Amino]Methyl}Carbamate |