|
CAS#: 10367-88-1 Product: 2-(Diethylamino)Ethyl 3-Methylbenzoate No suppilers available for the product. |
| Name | 2-(Diethylamino)Ethyl 3-Methylbenzoate |
|---|---|
| Synonyms | 2-(Diethylamino)ethyl 3-methylbenzoate #; 3-Methyl-benzoic acid, 2-diethylaminoethyl ester; NSC75134 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.32 |
| CAS Registry Number | 10367-88-1 |
| SMILES | O=C(OCCN(CC)CC)c1cc(ccc1)C |
| InChI | 1S/C14H21NO2/c1-4-15(5-2)9-10-17-14(16)13-8-6-7-12(3)11-13/h6-8,11H,4-5,9-10H2,1-3H3 |
| InChIKey | NHHMPVPZDJSKJU-UHFFFAOYSA-N |
| Density | 1.008g/cm3 (Cal.) |
|---|---|
| Boiling point | 328.676°C at 760 mmHg (Cal.) |
| Flash point | 112.993°C (Cal.) |
| Refractive index | 1.509 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Diethylamino)Ethyl 3-Methylbenzoate |