|
CAS#: 103878-96-2 Product: [2-Hydroxy-4-(2-Methylaminoethyl)Phenyl] Dihydrogen Phosphate No suppilers available for the product. |
| Name | [2-Hydroxy-4-(2-Methylaminoethyl)Phenyl] Dihydrogen Phosphate |
|---|---|
| Synonyms | 1,2-Benzenediol, 4-(2-(Methylamino)Ethyl)-, 1-(Dihydrogen Phosphate); 4-(2-(Methylamino)Ethyl)Pyrocatechol 1-(Dihydrogen Phosphate); Fosopamine |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14NO5P |
| Molecular Weight | 247.19 |
| CAS Registry Number | 103878-96-2 |
| SMILES | C1=CC(=CC(=C1O[P](O)(O)=O)O)CCNC |
| InChI | 1S/C9H14NO5P/c1-10-5-4-7-2-3-9(8(11)6-7)15-16(12,13)14/h2-3,6,10-11H,4-5H2,1H3,(H2,12,13,14) |
| InChIKey | WHEGQKBWPSOMHG-UHFFFAOYSA-N |
| Density | 1.432g/cm3 (Cal.) |
|---|---|
| Boiling point | 463.637°C at 760 mmHg (Cal.) |
| Flash point | 234.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [2-Hydroxy-4-(2-Methylaminoethyl)Phenyl] Dihydrogen Phosphate |