Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-Adamantanecarbonyl Fluoride |
|---|---|
| Synonyms | 1-Adamantancarbonylfluorid; 1-Adamantanecarbonyl fluoride; adamantane-1-carbonyl fluoride |
| Molecular Structure |  |
| Molecular Formula | C11H15FO |
| Molecular Weight | 182.23 |
| CAS Registry Number | 10405-61-5 |
| SMILES | C1C2CC3CC1CC(C2)(C3)C(=O)F |
| InChI | 1S/C11H15FO/c12-10(13)11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6H2 |
| InChIKey | RGDWWJZTKRRCIM-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 245.9±7.0°C at 760 mmHg (Cal.) |
| Flash point | 93.4±12.3°C (Cal.) |
| Refractive index | 1.519 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Adamantanecarbonyl Fluoride |