Online Database of Chemicals from Around the World
|
CAS#: 104259-19-0 Product: (2R,4S)-2-[(1E,3E)-1,3-Pentadien-1-Yl]-4-Piperidinol No suppilers available for the product. |
| Name | (2R,4S)-2-[(1E,3E)-1,3-Pentadien-1-Yl]-4-Piperidinol |
|---|---|
| Molecular Structure | ![CAS#: 104259-19-0， (2R,4S)-2-[(1E,3E)-1,3-Pentadien-1-Yl]-4-Piperidinol](/moreStructures/104259-19-0.gif) |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 |
| CAS Registry Number | 104259-19-0 |
| SMILES | O[C@@H]1C[C@H](/C=C/C=C/C)NCC1 |
| InChI | 1S/C10H17NO/c1-2-3-4-5-9-8-10(12)6-7-11-9/h2-5,9-12H,6-8H2,1H3/b3-2+,5-4+/t9-,10-/m0/s1 |
| InChIKey | HUJDEHIXVKEMDT-WIGPCGMCSA-N |
| Density | 1.032g/cm3 (Cal.) |
|---|---|
| Boiling point | 278.893°C at 760 mmHg (Cal.) |
| Flash point | 103.108°C (Cal.) |
| Refractive index | 1.568 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R,4S)-2-[(1E,3E)-1,3-Pentadien-1-Yl]-4-Piperidinol |