Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 6-Methyl-4-Oxo-4H-Furo[3,2-c]Pyran-3-Carbonyl Chloride |
|---|---|
| Synonyms | 6-methyl-4-oxo-4H-furo[3,2-c]pyran-3-carbonyl chloride |
| Molecular Structure | ![CAS#: 104270-66-8， 6-Methyl-4-Oxo-4H-Furo[3,2-c]Pyran-3-Carbonyl Chloride](/moreStructures/104270-66-8.gif) |
| Molecular Formula | C9H5ClO4 |
| Molecular Weight | 212.59 |
| CAS Registry Number | 104270-66-8 |
| SMILES | ClC(=O)c1coc2/C=C(/C)OC(=O)c12 |
| InChI | 1S/C9H5ClO4/c1-4-2-6-7(9(12)14-4)5(3-13-6)8(10)11/h2-3H,1H3 |
| InChIKey | YWJCVHOXEDKRJL-UHFFFAOYSA-N |
| Density | 1.473g/cm3 (Cal.) |
|---|---|
| Boiling point | 357.075°C at 760 mmHg (Cal.) |
| Flash point | 169.753°C (Cal.) |
| Refractive index | 1.565 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methyl-4-Oxo-4H-Furo[3,2-c]Pyran-3-Carbonyl Chloride |