Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| CiVentiChem - Simple Solutions for Complex Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (919) 678-0702 | |||
|
sales@cvchem.com | |||
| Chemical manufacturer since 1994 | ||||
| Name | (2R)-2-(Benzyloxy)-2-[(4S)-2,2-Dimethyl-1,3-Dioxolan-4-Yl]Ethanol |
|---|---|
| Synonyms | (2S,3S)-2-Benzyloxy-3,4-O-isopropylidene-butan-1-ol |
| Molecular Structure | ![CAS#: 104322-67-0， (2R)-2-(Benzyloxy)-2-[(4S)-2,2-Dimethyl-1,3-Dioxolan-4-Yl]Ethanol](/moreStructures/104322-67-0.gif) |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 |
| CAS Registry Number | 104322-67-0 |
| SMILES | OC[C@@H](OCc1ccccc1)[C@H]2OC(C)(C)OC2 |
| InChI | 1S/C14H20O4/c1-14(2)17-10-13(18-14)12(8-15)16-9-11-6-4-3-5-7-11/h3-7,12-13,15H,8-10H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | BCACQGHYULTSHT-OLZOCXBDSA-N |
| Density | 1.117g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.239°C at 760 mmHg (Cal.) |
| Flash point | 181.343°C (Cal.) |
| Refractive index | 1.513 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R)-2-(Benzyloxy)-2-[(4S)-2,2-Dimethyl-1,3-Dioxolan-4-Yl]Ethanol |