Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Paragos e. K. | Germany | Inquire | ||
|---|---|---|---|---|
|
+49 2330-8079751 | |||
|
sales@paragos.de | |||
| Chemical manufacturer since 2001 | ||||
| Name | Cyclobutyl 4-Methylbenzenesulfonate |
|---|---|
| Synonyms | Cyclobutanol, 1-(4-methylbenzenesulfonate); Toluene-4-sulfonic acid cyclobutyl ester |
| Molecular Structure |  |
| Molecular Formula | C11H14O3S |
| Molecular Weight | 226.29 |
| CAS Registry Number | 10437-85-1 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2CCC2 |
| InChI | 1S/C11H14O3S/c1-9-5-7-11(8-6-9)15(12,13)14-10-3-2-4-10/h5-8,10H,2-4H2,1H3 |
| InChIKey | XYXWCEWUIUOMAU-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 351.9±11.0°C at 760 mmHg (Cal.) |
| Flash point | 166.6±19.3°C (Cal.) |
| Refractive index | 1.563 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cyclobutyl 4-Methylbenzenesulfonate |