|
CAS#: 10440-42-3 Product: Glafenic Acid No suppilers available for the product. |
| Name | Glafenic Acid |
|---|---|
| Synonyms | 2-[(7-Chloro-4-Quinolyl)Amino]Benzoic Acid; Glafenic Acid; Oprea1_565721 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H11ClN2O2 |
| Molecular Weight | 298.73 |
| CAS Registry Number | 10440-42-3 |
| SMILES | C1=CC(=CC2=C1C(=CC=N2)NC3=C(C(=O)O)C=CC=C3)Cl |
| InChI | 1S/C16H11ClN2O2/c17-10-5-6-11-14(7-8-18-15(11)9-10)19-13-4-2-1-3-12(13)16(20)21/h1-9H,(H,18,19)(H,20,21) |
| InChIKey | HTKGKUISLUERQX-UHFFFAOYSA-N |
| Density | 1.441g/cm3 (Cal.) |
|---|---|
| Boiling point | 486.752°C at 760 mmHg (Cal.) |
| Flash point | 248.179°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Glafenic Acid |