Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
|
+44 (845) 299-6009/ | |||
|
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | Methyl 2-(4-Chlorophenyl)-3-Methylbutanoate |
|---|---|
| Synonyms | Methyl 2-(4-Chlorophenyl)-3-Methyl-Butanoate; 2-(4-Chlorophenyl)-3-Methylbutanoic Acid Methyl Ester; 2-(4-Chlorophenyl)-3-Methyl-Butyric Acid Methyl Ester |
| Molecular Structure |  |
| Molecular Formula | C12H15ClO2 |
| Molecular Weight | 226.70 |
| CAS Registry Number | 104486-05-7 |
| SMILES | C1=C(C(C(OC)=O)C(C)C)C=CC(=C1)Cl |
| InChI | 1S/C12H15ClO2/c1-8(2)11(12(14)15-3)9-4-6-10(13)7-5-9/h4-8,11H,1-3H3 |
| InChIKey | YLOVJTBYAMJJPN-UHFFFAOYSA-N |
| Density | 1.107g/cm3 (Cal.) |
|---|---|
| Boiling point | 280.948°C at 760 mmHg (Cal.) |
| Flash point | 127.872°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2-(4-Chlorophenyl)-3-Methylbutanoate |