Online Database of Chemicals from Around the World
|
CAS#: 10455-77-3 Product: 4-Methylthiodimethyltryptamine No suppilers available for the product. |
| Name | 4-Methylthiodimethyltryptamine |
|---|---|
| Synonyms | N,N-Dimethyl-2-[4-(Methylthio)-1H-Indol-3-Yl]Ethanamine; Dimethyl-[2-[4-(Methylthio)-1H-Indol-3-Yl]Ethyl]Amine; 1H-Indole-3-Ethanamine, N,N-Dimethyl-4-(Methylthio)- |
| Molecular Structure |  |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.36 |
| CAS Registry Number | 10455-77-3 |
| SMILES | C1=C(C2=C([NH]1)C=CC=C2SC)CCN(C)C |
| InChI | 1S/C13H18N2S/c1-15(2)8-7-10-9-14-11-5-4-6-12(16-3)13(10)11/h4-6,9,14H,7-8H2,1-3H3 |
| InChIKey | YWCOPJQNWPEWQP-UHFFFAOYSA-N |
| Density | 1.138g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.288°C at 760 mmHg (Cal.) |
| Flash point | 195.888°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methylthiodimethyltryptamine |