Online Database of Chemicals from Around the World
|
CAS#: 10463-17-9 Product: 4-Hydroxy-3-Iodo-5-Nitrobenzoic Acid No suppilers available for the product. |
| Name | 4-Hydroxy-3-Iodo-5-Nitrobenzoic Acid |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C7H4INO5 |
| Molecular Weight | 309.01 |
| CAS Registry Number | 10463-17-9 |
| SMILES | Ic1cc(cc(N(=O)=O)c1O)C(O)=O |
| InChI | 1S/C7H4INO5/c8-4-1-3(7(11)12)2-5(6(4)10)9(13)14/h1-2,10H,(H,11,12) |
| InChIKey | OVNWFZWJHJVRGG-UHFFFAOYSA-N |
| Density | 2.301g/cm3 (Cal.) |
|---|---|
| Boiling point | 347.29°C at 760 mmHg (Cal.) |
| Flash point | 163.835°C (Cal.) |
| Refractive index | 1.746 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Hydroxy-3-Iodo-5-Nitrobenzoic Acid |