Online Database of Chemicals from Around the World
|
CAS#: 104642-21-9 Product: 3H-Cyclonona(def)Biphenylene No suppilers available for the product. |
| Name | 3H-Cyclonona(def)Biphenylene |
|---|---|
| Synonyms | 3H-Cyclonona[Def]Biphenylene |
| Molecular Structure |  |
| Molecular Formula | C17H12 |
| Molecular Weight | 216.28 |
| CAS Registry Number | 104642-21-9 |
| SMILES | C1=C2C3=C(C=C1)\C=C/C\C=C/C4=CC=CC2=C34 |
| InChI | 1S/C17H12/c1-2-6-12-8-4-10-14-15-11-5-9-13(7-3-1)17(15)16(12)14/h2-11H,1H2/b6-2-,7-3- |
| InChIKey | FNQKRQMQQQHBTE-PORYWJCVSA-N |
| Density | 1.206g/cm3 (Cal.) |
|---|---|
| Boiling point | 606.095°C at 760 mmHg (Cal.) |
| Flash point | 266.636°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3H-Cyclonona(def)Biphenylene |