Online Database of Chemicals from Around the World
|
CAS#: 10469-83-7 Product: 1-Phenoxy-3-(4-Phenoxyphenoxy)Benzene No suppilers available for the product. |
| Name | 1-Phenoxy-3-(4-Phenoxyphenoxy)Benzene |
|---|---|
| Synonyms | Benzene, 1-Phenoxy-3-(4-Phenoxyphenoxy)- |
| Molecular Structure |  |
| Molecular Formula | C24H18O3 |
| Molecular Weight | 354.40 |
| CAS Registry Number | 10469-83-7 |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)OC3=CC(=CC=C3)OC4=CC=CC=C4 |
| InChI | 1S/C24H18O3/c1-3-8-19(9-4-1)25-21-14-16-22(17-15-21)27-24-13-7-12-23(18-24)26-20-10-5-2-6-11-20/h1-18H |
| InChIKey | GWXBGFIYQHKUSH-UHFFFAOYSA-N |
| Density | 1.177g/cm3 (Cal.) |
|---|---|
| Boiling point | 472.995°C at 760 mmHg (Cal.) |
| Flash point | 162.055°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Phenoxy-3-(4-Phenoxyphenoxy)Benzene |