Online Database of Chemicals from Around the World
|
CAS#: 104719-71-3 Product: Lorcinadol No suppilers available for the product. |
| Name | Lorcinadol |
|---|---|
| Synonyms | 3-Chloro-6-[4-[(E)-3-Phenylprop-2-Enyl]-1-Piperazinyl]Pyridazine; Lorcinadol; Lorcinadol [Usan:Ban:Inn] |
| Molecular Structure |  |
| Molecular Formula | C17H19ClN4 |
| Molecular Weight | 314.82 |
| CAS Registry Number | 104719-71-3 |
| SMILES | C3=C(N2CCN(C\C=C\C1=CC=CC=C1)CC2)N=NC(=C3)Cl |
| InChI | 1S/C17H19ClN4/c18-16-8-9-17(20-19-16)22-13-11-21(12-14-22)10-4-7-15-5-2-1-3-6-15/h1-9H,10-14H2/b7-4+ |
| InChIKey | NCPBMOFVRBEVJY-QPJJXVBHSA-N |
| Density | 1.222g/cm3 (Cal.) |
|---|---|
| Boiling point | 532.784°C at 760 mmHg (Cal.) |
| Flash point | 276.018°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lorcinadol |