Online Database of Chemicals from Around the World
|
CAS#: 10480-27-0 Product: N-(3-Chlorophenyl)-3-Nitrobenzenemethanimine No suppilers available for the product. |
| Name | N-(3-Chlorophenyl)-3-Nitrobenzenemethanimine |
|---|---|
| Synonyms | (3-Chlorophenyl)-(3-Nitrobenzylidene)Amine; Nsc204479 |
| Molecular Structure |  |
| Molecular Formula | C13H9ClN2O2 |
| Molecular Weight | 260.68 |
| CAS Registry Number | 10480-27-0 |
| SMILES | C1=C(C=CC=C1C=NC2=CC(=CC=C2)Cl)[N+](=O)[O-] |
| InChI | 1S/C13H9ClN2O2/c14-11-4-2-5-12(8-11)15-9-10-3-1-6-13(7-10)16(17)18/h1-9H |
| InChIKey | OVBDZJKHSCHXBO-UHFFFAOYSA-N |
| Density | 1.276g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.385°C at 760 mmHg (Cal.) |
| Flash point | 208.646°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-(3-Chlorophenyl)-3-Nitrobenzenemethanimine |