Online Database of Chemicals from Around the World
|
CAS#: 10484-23-8 Product: 5,6,7,8-Tetrahydronaphthalene-1-Acetaldehyde No suppilers available for the product. |
| Name | 5,6,7,8-Tetrahydronaphthalene-1-Acetaldehyde |
|---|---|
| Synonyms | 2-Tetralin-5-Ylacetaldehyde; 2-(5-Tetralinyl)Acetaldehyde; 2-(5,6,7,8-Tetrahydronaphthalen-1-Yl)Ethanal |
| Molecular Structure |  |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 |
| CAS Registry Number | 10484-23-8 |
| EINECS | 233-994-1 |
| SMILES | C1=CC2=C(C(=C1)CC=O)CCCC2 |
| InChI | 1S/C12H14O/c13-9-8-11-6-3-5-10-4-1-2-7-12(10)11/h3,5-6,9H,1-2,4,7-8H2 |
| InChIKey | CIHPERNEECLJMM-UHFFFAOYSA-N |
| Density | 1.047g/cm3 (Cal.) |
|---|---|
| Boiling point | 293.893°C at 760 mmHg (Cal.) |
| Flash point | 151.705°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6,7,8-Tetrahydronaphthalene-1-Acetaldehyde |