Online Database of Chemicals from Around the World
|
CAS#: 10516-92-4 Product: 1,2,3,4-Tetraphenyl-1,4-Butanedione No suppilers available for the product. |
| Name | 1,2,3,4-Tetraphenyl-1,4-Butanedione |
|---|---|
| Synonyms | 1,2,3,4-Tetraphenyl-1,4-butanedione # |
| Molecular Structure |  |
| Molecular Formula | C28H22O2 |
| Molecular Weight | 390.47 |
| CAS Registry Number | 10516-92-4 |
| SMILES | O=C(c1ccccc1)C(c2ccccc2)C(c3ccccc3)C(=O)c4ccccc4 |
| InChI | 1S/C28H22O2/c29-27(23-17-9-3-10-18-23)25(21-13-5-1-6-14-21)26(22-15-7-2-8-16-22)28(30)24-19-11-4-12-20-24/h1-20,25-26H |
| InChIKey | SLHKSCFJQMEDTP-UHFFFAOYSA-N |
| Density | 1.161g/cm3 (Cal.) |
|---|---|
| Boiling point | 572.789°C at 760 mmHg (Cal.) |
| Flash point | 209.05°C (Cal.) |
| Refractive index | 1.629 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4-Tetraphenyl-1,4-Butanedione |