Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Glycyl-L-alpha-Aspartylglycine |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C8H13N3O6 |
| Molecular Weight | 247.21 |
| CAS Registry Number | 10517-27-8 |
| SMILES | O=C(NCC(=O)O)[C@@H](NC(=O)CN)CC(=O)O |
| InChI | 1S/C8H13N3O6/c9-2-5(12)11-4(1-6(13)14)8(17)10-3-7(15)16/h4H,1-3,9H2,(H,10,17)(H,11,12)(H,13,14)(H,15,16)/t4-/m0/s1 |
| InChIKey | SUENNJKZJSVCKD-BYPYZUCNSA-N |
| Density | 1.491g/cm3 (Cal.) |
|---|---|
| Boiling point | 746.483°C at 760 mmHg (Cal.) |
| Flash point | 405.258°C (Cal.) |
| Refractive index | 1.552 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Glycyl-L-alpha-Aspartylglycine |