Online Database of Chemicals from Around the World
|
CAS#: 105367-21-3 Product: (2S)-Hydroxy(3-Methylphenyl)Acetonitrile No suppilers available for the product. |
| Name | (2S)-Hydroxy(3-Methylphenyl)Acetonitrile |
|---|---|
| Synonyms | (S)-3-Methylmandelonitrile |
| Molecular Structure |  |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.17 |
| CAS Registry Number | 105367-21-3 |
| SMILES | CC1=CC(=CC=C1)[C@@H](C#N)O |
| InChI | 1S/C9H9NO/c1-7-3-2-4-8(5-7)9(11)6-10/h2-5,9,11H,1H3/t9-/m1/s1 |
| InChIKey | QJOHNFPAIZBELI-SECBINFHSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 296.3±25.0°C at 760 mmHg (Cal.) |
| Flash point | 133.0±23.2°C (Cal.) |
| Refractive index | 1.56 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-Hydroxy(3-Methylphenyl)Acetonitrile |