|
CAS#: 10541-29-4 Product: N-Methyl-O-Toluidine Hydrochloride No suppilers available for the product. |
| Name | N-Methyl-O-Toluidine Hydrochloride |
|---|---|
| Synonyms | Methyl-(O-Tolyl)Amine Hydrochloride; N-Methyl-O-Toluidine Hydrochloride |
| Molecular Formula | C8H12ClN |
| Molecular Weight | 157.64 |
| CAS Registry Number | 10541-29-4 |
| EINECS | 234-119-6 |
| SMILES | [H+].C1=CC(=C(C=C1)NC)C.[Cl-] |
| InChI | 1S/C8H11N.ClH/c1-7-5-3-4-6-8(7)9-2;/h3-6,9H,1-2H3;1H |
| InChIKey | UNLGXHLMMSXFBP-UHFFFAOYSA-N |
| Boiling point | 207.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 76.4°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-Methyl-O-Toluidine Hydrochloride |