|
CAS#: 105523-37-3 Product: Tiprotimod No suppilers available for the product. |
| Name | Tiprotimod |
|---|---|
| Synonyms | 4-[5-(Carboxymethyl)-4-Methyl-Thiazol-2-Yl]Sulfanylbutanoic Acid; 4-[[5-(Carboxymethyl)-4-Methyl-2-Thiazolyl]Thio]Butanoic Acid; 4-[[5-(Carboxymethyl)-4-Methyl-Thiazol-2-Yl]Thio]Butyric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13NO4S2 |
| Molecular Weight | 275.34 |
| CAS Registry Number | 105523-37-3 |
| SMILES | C(SC1=NC(=C(S1)CC(O)=O)C)CCC(O)=O |
| InChI | 1S/C10H13NO4S2/c1-6-7(5-9(14)15)17-10(11-6)16-4-2-3-8(12)13/h2-5H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | PZEUAMSVHLMPBZ-UHFFFAOYSA-N |
| Density | 1.447g/cm3 (Cal.) |
|---|---|
| Boiling point | 538.567°C at 760 mmHg (Cal.) |
| Flash point | 279.516°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tiprotimod |