Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,3,5-Tri-Tert-Butylhexahydro-1,3,5-Triazine |
|---|---|
| Synonyms | 1,3,5-Tri-Tert-Butylhexahydro-1,3,5-Triazine; 1,3,5-Triazine, 1,3,5-Tris(1,1-Dimethylethyl)Hexahydro- |
| Molecular Structure |  |
| Molecular Formula | C15H33N3 |
| Molecular Weight | 255.45 |
| CAS Registry Number | 10560-39-1 |
| EINECS | 234-145-8 |
| SMILES | CC(N1CN(CN(C1)C(C)(C)C)C(C)(C)C)(C)C |
| InChI | 1S/C15H33N3/c1-13(2,3)16-10-17(14(4,5)6)12-18(11-16)15(7,8)9/h10-12H2,1-9H3 |
| InChIKey | XNJJKNFDJBAYSE-UHFFFAOYSA-N |
| Density | 0.918g/cm3 (Cal.) |
|---|---|
| Boiling point | 287.5°C at 760 mmHg (Cal.) |
| Flash point | 113.009°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,5-Tri-Tert-Butylhexahydro-1,3,5-Triazine |