Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (1R,3S)-3-Sulfanylcyclopentanecarboxamide |
|---|---|
| Synonyms | (1R,3S)-3-mercaptocyclopentanecarboxamide |
| Molecular Structure |  |
| Molecular Formula | C6H11NOS |
| Molecular Weight | 145.22 |
| CAS Registry Number | 105676-07-1 |
| SMILES | C1C[C@@H](C[C@@H]1C(=O)N)S |
| InChI | 1S/C6H11NOS/c7-6(8)4-1-2-5(9)3-4/h4-5,9H,1-3H2,(H2,7,8)/t4-,5+/m1/s1 |
| InChIKey | FTIBJSUCUSZUQU-UHNVWZDZSA-N |
| Density | 1.155g/cm3 (Cal.) |
|---|---|
| Boiling point | 329.781°C at 760 mmHg (Cal.) |
| Flash point | 153.246°C (Cal.) |
| Refractive index | 1.538 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,3S)-3-Sulfanylcyclopentanecarboxamide |