Online Database of Chemicals from Around the World
|
CAS#: 105705-86-0 Product: Yanangine No suppilers available for the product. |
| Name | Yanangine |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C36H36N2O6 |
| Molecular Weight | 592.69 |
| CAS Registry Number | 105705-86-0 |
| SMILES | C1=C8C7=CC4=C1OC3=C(C(=C2CCN(C(C2=C3O4)CC5=CC=C(OC)C(=C5)C6=C(O)C=CC(=C6)CC7N(CC8)C)C)O)OC |
| InChI | 1S/C36H36N2O6/c1-37-11-9-21-17-30-31-18-23(21)26(37)15-19-5-7-28(39)24(13-19)25-14-20(6-8-29(25)41-3)16-27-32-22(10-12-38(27)2)33(40)35(42-4)36(44-30)34(32)43-31/h5-8,13-14,17-18,26-27,39-40H,9-12,15-16H2,1-4H3 |
| InChIKey | SKVLZQWBNXMJEZ-UHFFFAOYSA-N |
| Density | 1.3g/cm3 (Cal.) |
|---|---|
| Boiling point | 734.411°C at 760 mmHg (Cal.) |
| Flash point | 397.958°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Yanangine |