Online Database of Chemicals from Around the World
| Name | Dibutyl[Bis(Pentafluorophenyl)]Stannane |
|---|---|
| Synonyms | Dibutyl[bis(2,3,4,5,6-pentafluorophenyl)]stannane #; Tin, dibutylbis(pentafluorophenyl)- |
| Molecular Structure | ![CAS#: 1059-35-4， Dibutyl[Bis(Pentafluorophenyl)]Stannane](/moreStructures/1059-35-4.gif) |
| Molecular Formula | C20H18F10Sn |
| Molecular Weight | 567.05 |
| CAS Registry Number | 1059-35-4 |
| SMILES | Fc1c(c(F)c(F)c(F)c1F)[Sn](c2c(F)c(F)c(F)c(F)c2F)(CCCC)CCCC |
| InChI | 1S/2C6F5.2C4H9.Sn/c2*7-2-1-3(8)5(10)6(11)4(2)9;2*1-3-4-2;/h;;2*1,3-4H2,2H3; |
| InChIKey | MAMQYHJRFYBYAM-UHFFFAOYSA-N |
| Boiling point | 394.117°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 192.155°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dibutyl[Bis(Pentafluorophenyl)]Stannane |
