Online Database of Chemicals from Around the World
| Creative Peptides | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 624-4882 | |||
 |
info@creative-peptides.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+86 (21) 6141-5566 / 800-819-3336 | |||
|
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | N-Formylmethionylleucyl-4-Iodophenylalanine |
|---|---|
| Synonyms | N-Formyl-Met-Leu-p-iodo-Phe; F6882_SIGMA; NSC350594 |
| Molecular Structure |  |
| Molecular Formula | C21H30IN3O5S |
| Molecular Weight | 563.45 |
| CAS Registry Number | 105931-59-7 |
| SMILES | Ic1ccc(cc1)CC(C(=O)O)NC(=O)C(NC(=O)C(NC=O)CCSC)CC(C)C |
| InChI | 1S/C21H30IN3O5S/c1-13(2)10-17(24-19(27)16(23-12-26)8-9-31-3)20(28)25-18(21(29)30)11-14-4-6-15(22)7-5-14/h4-7,12-13,16-18H,8-11H2,1-3H3,(H,23,26)(H,24,27)(H,25,28)(H,29,30) |
| InChIKey | RDQXFDPVOCUTTL-UHFFFAOYSA-N |
| Protein Sequence | For-Met-Leu-p-iodo-Phe-OH |
| Density | 1.456g/cm3 (Cal.) |
|---|---|
| Boiling point | 815.565°C at 760 mmHg (Cal.) |
| Flash point | 447.038°C (Cal.) |
| Refractive index | 1.583 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Formylmethionylleucyl-4-Iodophenylalanine |