Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Name | 9-Amino-6-Methyl-5,6,6a,7-Tetrahydro-4H-Benzo-(de)Thiazolo(4,5-g)Quinoline |
|---|---|
| Synonyms | 9-Amtbtq |
| Molecular Structure |  |
| Molecular Formula | C14H15N3S |
| Molecular Weight | 257.35 |
| CAS Registry Number | 106006-79-5 |
| SMILES | C2=CC=C1CCN(C3C1=C2C4=C(C3)SC(=N4)N)C |
| InChI | 1S/C14H15N3S/c1-17-6-5-8-3-2-4-9-12(8)10(17)7-11-13(9)16-14(15)18-11/h2-4,10H,5-7H2,1H3,(H2,15,16) |
| InChIKey | HHCIBEMTUSEDSI-UHFFFAOYSA-N |
| Density | 1.328g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.263°C at 760 mmHg (Cal.) |
| Flash point | 229.74°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Amino-6-Methyl-5,6,6a,7-Tetrahydro-4H-Benzo-(de)Thiazolo(4,5-g)Quinoline |