Online Database of Chemicals from Around the World
|
CAS#: 106114-40-3 Product: 3-Iodopropyl Trifluoromethanesulfonate No suppilers available for the product. |
| Name | 3-Iodopropyl Trifluoromethanesulfonate |
|---|---|
| Synonyms | Trifluoromethanesulfonic Acid 3-Iodopropyl Ester; 3-Iodopropyl-1-Triflate; 3-Iodopropyl-1-Trifluoromethanesulfonate |
| Molecular Structure |  |
| Molecular Formula | C4H6F3IO3S |
| Molecular Weight | 318.05 |
| CAS Registry Number | 106114-40-3 |
| SMILES | C(O[S](C(F)(F)F)(=O)=O)CCI |
| InChI | 1S/C4H6F3IO3S/c5-4(6,7)12(9,10)11-3-1-2-8/h1-3H2 |
| InChIKey | FMSOAEQMFVDTSC-UHFFFAOYSA-N |
| Density | 2.024g/cm3 (Cal.) |
|---|---|
| Boiling point | 236.338°C at 760 mmHg (Cal.) |
| Flash point | 96.734°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Iodopropyl Trifluoromethanesulfonate |