Online Database of Chemicals from Around the World
|
CAS#: 106220-84-2 Product: 1,2,3,5-Tetrachloro-4-(2,4,6-Trichlorophenoxy)Benzene No suppilers available for the product. |
| Name | 1,2,3,5-Tetrachloro-4-(2,4,6-Trichlorophenoxy)Benzene |
|---|---|
| Synonyms | 2,2',3,4,4',6,6'-Heptachlorodiphenyl Ether; 2,2-Hpcde; Benzene, 1,2,3,5-Tetrachloro-4-(2,4,6-Trichlorophenoxy)- |
| Molecular Structure |  |
| Molecular Formula | C12H3Cl7O |
| Molecular Weight | 411.33 |
| CAS Registry Number | 106220-84-2 |
| SMILES | C1=C(C(=C(C(=C1Cl)OC2=C(C=C(C=C2Cl)Cl)Cl)Cl)Cl)Cl |
| InChI | 1S/C12H3Cl7O/c13-4-1-6(15)11(7(16)2-4)20-12-8(17)3-5(14)9(18)10(12)19/h1-3H |
| InChIKey | WTYSJAGEYAAIFW-UHFFFAOYSA-N |
| Density | 1.688g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.136°C at 760 mmHg (Cal.) |
| Flash point | 130.532°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,5-Tetrachloro-4-(2,4,6-Trichlorophenoxy)Benzene |