|
CAS#: 106854-46-0 Product: (2S)-2-Amino-5-(Diaminomethylideneamino)Pentanoic Acid, 2-Sulfanylethanesulfonic Acid No suppilers available for the product. |
| Name | (2S)-2-Amino-5-(Diaminomethylideneamino)Pentanoic Acid, 2-Sulfanylethanesulfonic Acid |
|---|---|
| Synonyms | (2S)-2-Amino-5-Guanidino-Pentanoic Acid; 2-Sulfanylethanesulfonic Acid; (2S)-2-Amino-5-Guanidinopentanoic Acid; 2-Mercaptoethanesulfonic Acid; (2S)-2-Amino-5-Guanidino-Valeric Acid; 2-Mercaptoethanesulfonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C8H20N4O5S2 |
| Molecular Weight | 316.39 |
| CAS Registry Number | 106854-46-0 |
| SMILES | [C@H](N)(CCCN=C(N)N)C(O)=O.C([S](O)(=O)=O)CS |
| InChI | 1S/C6H14N4O2.C2H6O3S2/c7-4(5(11)12)2-1-3-10-6(8)9;3-7(4,5)2-1-6/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);6H,1-2H2,(H,3,4,5)/t4-;/m0./s1 |
| InChIKey | MZDDDSNBRVMDIH-WCCKRBBISA-N |
| Boiling point | 409.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 201.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-2-Amino-5-(Diaminomethylideneamino)Pentanoic Acid, 2-Sulfanylethanesulfonic Acid |