Online Database of Chemicals from Around the World
4,4,5,5-Tetramethyl-2-(2,3,4,5-tetrafluorophenyl)-1,3,2-dioxaborolane
[CAS# 1073339-20-4]
Identification| Name | 4,4,5,5-Tetramethyl-2-(2,3,4,5-tetrafluorophenyl)-1,3,2-dioxaborolane |
|---|
|
| Molecular Structure |  |
| Molecular Formula | C12H13BF4O2 |
| Molecular Weight | 276.04 |
| CAS Registry Number | 1073339-20-4 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2F)F)F)F |
|
Properties
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.448, Calc.* |
| Boiling Point | 282.9±40.0 °C (760 mmHg), Calc.* |
| Flash Point | 124.9±27.3 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Related Products
Tetramethyltere... Tetramethyltere... Tetramethyl-2-t... 1,4,7,10-Tetram... N,N',N'',N'''-T... 6,10,15,19-Tetr... Tetramethyl (2R... 2,2,3,3-Tetrame... 2,2,9,9-Tetrame... 4,4,5,5-Tetrame... 4,4,5,5-Tetrame... (3aR,5S,5aR,8aS... 2,2,7,7-Tetrame... 1-[(3aS,5aR,8aR... 1-[(3aR,5aS,8aS... [(3aR,5S,5aR,8a... (6aR,10aR)-1,6,... 5',5',8',8'-Tet... 1,1',3,3'-Tetra... 2,2,7,7-Tetrame...