Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-(trans-3-Chloro-3-Methylcyclobutyl)Ethanone |
|---|---|
| Synonyms | 1-((1r,3r)-3-chloro-3-methylcyclobutyl)ethanone |
| Molecular Structure |  |
| Molecular Formula | C7H11ClO |
| Molecular Weight | 146.61 |
| CAS Registry Number | 107693-41-4 |
| SMILES | CC(=O)[C@H]1C[C@@](C1)(Cl)C |
| InChI | 1S/C7H11ClO/c1-5(9)6-3-7(2,8)4-6/h6H,3-4H2,1-2H3/t6-,7- |
| InChIKey | HWZHEWLCCZGBCR-LJGSYFOKSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 197.7±33.0°C at 760 mmHg (Cal.) |
| Flash point | 89.7±16.5°C (Cal.) |
| Refractive index | 1.464 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(trans-3-Chloro-3-Methylcyclobutyl)Ethanone |