|
CAS#: 107843-95-8 Product: 1,2,3-Trichloro-4-(2-Chlorophenyl)-5,6-Dimethoxybenzene No suppilers available for the product. |
| Name | 1,2,3-Trichloro-4-(2-Chlorophenyl)-5,6-Dimethoxybenzene |
|---|---|
| Synonyms | 1,2,3-Trichloro-4-(2-Chlorophenyl)-5,6-Dimethoxy-Benzene; 1,1'-Biphenyl, Tetrachlorodimethoxy-; Tetrachlorodimethoxy-1,1'-Biphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10Cl4O2 |
| Molecular Weight | 352.04 |
| CAS Registry Number | 107843-95-8 |
| SMILES | C1=C(C(=CC=C1)C2=C(C(=C(C(=C2OC)OC)Cl)Cl)Cl)Cl |
| InChI | 1S/C14H10Cl4O2/c1-19-13-9(7-5-3-4-6-8(7)15)10(16)11(17)12(18)14(13)20-2/h3-6H,1-2H3 |
| InChIKey | IPHVCCXKFMRAOG-UHFFFAOYSA-N |
| Density | 1.405g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.115°C at 760 mmHg (Cal.) |
| Flash point | 123.47°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3-Trichloro-4-(2-Chlorophenyl)-5,6-Dimethoxybenzene |