Online Database of Chemicals from Around the World
Methyl 6-methyl-2,4-bis(2-nitrophenyl)-1,2,3,4-tetrahydropyrimidine-5-carboxylate
[CAS# 108139-78-2]
Identification| Name | Methyl 6-methyl-2,4-bis(2-nitrophenyl)-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
|---|
|
| Molecular Structure |  |
| Molecular Formula | C19H18N4O6 |
| Molecular Weight | 398.37 |
| CAS Registry Number | 108139-78-2 |
| SMILES | CC1=C(C(NC(N1)C2=CC=CC=C2[N+](=O)[O-])C3=CC=CC=C3[N+](=O)[O-])C(=O)OC |
|
Properties
| Solubility | 238.2 mg/L (25 °C water) |
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.604, Calc.* |
| Melting point | 236.60 °C |
| Boiling Point | 551.38 °C, 572.8±50.0 °C (760 mmHg), Calc.* |
| Flash Point | 300.2±30.1 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Related Products