Online Database of Chemicals from Around the World
(S)-1,3,4,6,7,12b-hexahydro-2H-benzofuro[2,3-a]quinolizin-2-one
[CAS# 108392-57-0]
Identification| Name | (S)-1,3,4,6,7,12b-hexahydro-2H-benzofuro[2,3-a]quinolizin-2-one |
|---|
|
| Molecular Structure | ![CAS # 108392-57-0, (S)-1,3,4,6,7,12b-hexahydro-2H-benzofuro[2,3-a]quinolizin-2-one](/structures/108392-57-0.gif) |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 |
| CAS Registry Number | 108392-57-0 |
| SMILES | C1CN2CCC3=C([C@@H]2CC1=O)OC4=CC=CC=C34 |
|
Properties
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.660, Calc.* |
| Boiling Point | 412.0±45.0 °C (760 mmHg), Calc.* |
| Flash Point | 203.0±28.7 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Related Products
Hexahydro-2-Ben... 5,6,7,8,9,10-He... 1,2,6,7,8,8a-He... 1,2,3,4,5,6-Hex... 3,4,5,6,7,8-Hex... Hexahydro-1,3-B... 2,4,5,6,7,7A-He... trans-Hexahydro... 1-(2,4,5,6,7,7A... (5aR,9aR)-5a,6,... 5,6,7,8,9,10-He... 2,3,3a,4,5,9b-H... 5,6,6A,7,8,12B-... 3,4,5,6,7,8-Hex... trans-N-(1,3,4,... trans-N-(1,3,4,... N-(1,3,4,6,7,11... 1,3,3a,4,7,7a-H... 1,3,3a,4,7,7a-H... 1,3,4,6,7,9-Hex...